C16H16F3N3O4S3 — CID 167963055
2,4-dimethyl-N-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]phenyl]sulfonyl-1,3-thiazole-5-carboxamide (PubChem CID 167963055) has the molecular formula C16H16F3N3O4S3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]phenyl]sulfonyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]phenyl]sulfonyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167963055 |
| Molecular Formula | C16H16F3N3O4S3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2,4-dimethyl-N-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]phenyl]sulfonyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCSC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C16H16F3N3O4S3/c1-9-13(28-10(2)21-9)15(24)22-29(25,26)12-5-3-11(4-6-12)14(23)20-7-8-27-16(17,18)19/h3-6H,7-8H2,1-2H3,(H,20,23)(H,22,24) |
| InChIKey | VBTKRNABQXVCSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|