C13H12F3N3OS2 — CID 71893810
1-(thiophen-2-ylmethyl)-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]thiourea (PubChem CID 71893810) has the molecular formula C13H12F3N3OS2 and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]thiourea.
| Compound Name | 1-(thiophen-2-ylmethyl)-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]thiourea |
|---|---|
| PubChem CID | 71893810 |
| Molecular Formula | C13H12F3N3OS2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]thiourea |
| SMILES | FC(F)(F)COc1ccc(NC(=S)NCc2cccs2)cn1 |
| InChI | InChI=1S/C13H12F3N3OS2/c14-13(15,16)8-20-11-4-3-9(6-17-11)19-12(21)18-7-10-2-1-5-22-10/h1-6H,7-8H2,(H2,18,19,21) |
| InChIKey | RKPFPXXNQDBJLT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|