C24H24N5O2+ — CID 7189487
4-(3-cyanopyridin-1-ium-2-yl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide (PubChem CID 7189487) has the molecular formula C24H24N5O2+ and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-(3-cyanopyridin-1-ium-2-yl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-cyanopyridin-1-ium-2-yl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 7189487 |
| Molecular Formula | C24H24N5O2+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-(3-cyanopyridin-1-ium-2-yl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide |
| SMILES | N#Cc1ccc[nH+]c1N1CCN(C(=O)Nc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H23N5O2/c25-17-20-7-4-12-26-23(20)28-13-15-29(16-14-28)24(30)27-21-8-10-22(11-9-21)31-18-19-5-2-1-3-6-19/h1-12H,13-16,18H2,(H,27,30)/p+1 |
| InChIKey | KYSUOGUUHDNDJO-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |