C17H16N2O3S2 — CID 7189631
3-(benzenesulfonyl)-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide (PubChem CID 7189631) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 7189631 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide |
| SMILES | Cc1nc2ccc(NC(=O)CCS(=O)(=O)c3ccccc3)cc2s1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-12-18-15-8-7-13(11-16(15)23-12)19-17(20)9-10-24(21,22)14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3,(H,19,20) |
| InChIKey | GTBJYPBFAQHHKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |