C25H27NO5 — CID 7189745
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-(4-propoxyphenyl)butanoate (PubChem CID 7189745) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-(4-propoxyphenyl)butanoate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-(4-propoxyphenyl)butanoate |
|---|---|
| PubChem CID | 7189745 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-(4-propoxyphenyl)butanoate |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)O[C@@H](C)C(=O)c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-4-15-30-19-11-9-18(10-12-19)22(27)13-14-23(28)31-17(3)25(29)24-16(2)26-21-8-6-5-7-20(21)24/h5-12,17,26H,4,13-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | QESGQJICAMNFGY-KRWDZBQOSA-N |
| XLogP | 5.04 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |