C19H18FN3OS — CID 71897876
N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 71897876) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 71897876 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | Cc1c(C(C)NC(=O)C=Cc2ccsc2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3OS/c1-13(22-19(24)8-3-15-9-10-25-12-15)18-11-21-23(14(18)2)17-6-4-16(20)5-7-17/h3-13H,1-2H3,(H,22,24) |
| InChIKey | LUQJGMWEMBECPE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|