C18H20FNOS — CID 55782625
(E)-N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 55782625) has the molecular formula C18H20FNOS and a molecular weight of 317.43 g/mol. Its IUPAC name is (E)-N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 55782625 |
| Molecular Formula | C18H20FNOS |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (E)-N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | CC(C)(C)C(NC(=O)/C=C/c1ccsc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNOS/c1-18(2,3)17(14-5-7-15(19)8-6-14)20-16(21)9-4-13-10-11-22-12-13/h4-12,17H,1-3H3,(H,20,21)/b9-4+ |
| InChIKey | NEUCYVUYJYSEEJ-RUDMXATFSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|