2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid

C13H17NO3S — CID 91943970

IUPAC2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid
SMILESCC(C)C(C)(NC(=O)C=Cc1ccsc1)C(=O)O
InChIInChI=1S/C13H17NO3S/c1-9(2)13(3,12(16)17)14-11(15)5-4-10-6-7-18-8-10/h4-9H,1-3H3,(H,14,15)(H,16,17)
InChIKeySPDGRNFIHNPASH-UHFFFAOYSA-N
MW267.35 g/mol
LogP2.38
Rot. Bonds5

About 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid

2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid (PubChem CID 91943970) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid.

Molecular Properties

Compound Name2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid
PubChem CID91943970
Molecular FormulaC13H17NO3S
Molecular Weight267.35 g/mol
Exact Mass267.09
IUPAC Name2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid
SMILESCC(C)C(C)(NC(=O)C=Cc1ccsc1)C(=O)O
InChIInChI=1S/C13H17NO3S/c1-9(2)13(3,12(16)17)14-11(15)5-4-10-6-7-18-8-10/h4-9H,1-3H3,(H,14,15)(H,16,17)
InChIKeySPDGRNFIHNPASH-UHFFFAOYSA-N
XLogP2.38
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.35
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid?
The IUPAC name of 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid (CID 91943970) is 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid.
What is the SMILES notation for 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid?
The canonical SMILES for 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid is CC(C)C(C)(NC(=O)C=Cc1ccsc1)C(=O)O.
What is the InChIKey of 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid?
The InChIKey is SPDGRNFIHNPASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-9(2)13(3,12(16)17)14-11(15)5-4-10-6-7-18-8-10/h4-9H,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid?
2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid has a molecular weight of 267.35 g/mol, XLogP of 2.38, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2-(3-thiophen-3-ylprop-2-enoylamino)butanoic acid is sourced from PubChem (CID 91943970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).