C22H21N5O — CID 71899303
N'-(4,6-dimethylpyrimidin-2-yl)-1-methyl-2-phenylindole-3-carbohydrazide (PubChem CID 71899303) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-1-methyl-2-phenylindole-3-carbohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-1-methyl-2-phenylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 71899303 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-1-methyl-2-phenylindole-3-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2c(-c3ccccc3)n(C)c3ccccc23)n1 |
| InChI | InChI=1S/C22H21N5O/c1-14-13-15(2)24-22(23-14)26-25-21(28)19-17-11-7-8-12-18(17)27(3)20(19)16-9-5-4-6-10-16/h4-13H,1-3H3,(H,25,28)(H,23,24,26) |
| InChIKey | RQJSWKOSJRYAQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|