C20H17N3O2 — CID 71900533
1-[1-(1-benzofuran-2-yl)ethyl]-3-isoquinolin-5-ylurea (PubChem CID 71900533) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 71900533 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-isoquinolin-5-ylurea |
| SMILES | CC(NC(=O)Nc1cccc2cnccc12)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H17N3O2/c1-13(19-11-14-5-2-3-8-18(14)25-19)22-20(24)23-17-7-4-6-15-12-21-10-9-16(15)17/h2-13H,1H3,(H2,22,23,24) |
| InChIKey | GQCYATWVUXLCII-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |