C18H19ClN4S — CID 71900889
1-(2-chloro-4,6-dimethylphenyl)-3-(2-ethylbenzimidazol-1-yl)thiourea (PubChem CID 71900889) has the molecular formula C18H19ClN4S and a molecular weight of 358.90 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-(2-ethylbenzimidazol-1-yl)thiourea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(2-ethylbenzimidazol-1-yl)thiourea |
|---|---|
| PubChem CID | 71900889 |
| Molecular Formula | C18H19ClN4S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(2-ethylbenzimidazol-1-yl)thiourea |
| SMILES | CCc1nc2ccccc2n1NC(=S)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C18H19ClN4S/c1-4-16-20-14-7-5-6-8-15(14)23(16)22-18(24)21-17-12(3)9-11(2)10-13(17)19/h5-10H,4H2,1-3H3,(H2,21,22,24) |
| InChIKey | VRSDIJPAJIOMGB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|