C24H22N2O5 — CID 71902504
methyl 3-[3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoylamino]benzoate (PubChem CID 71902504) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 3-[3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoylamino]benzoate.
| Compound Name | methyl 3-[3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 71902504 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 3-[3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C=Cc2cc(C)n(-c3ccc4c(c3)OCO4)c2C)c1 |
| InChI | InChI=1S/C24H22N2O5/c1-15-11-17(16(2)26(15)20-8-9-21-22(13-20)31-14-30-21)7-10-23(27)25-19-6-4-5-18(12-19)24(28)29-3/h4-13H,14H2,1-3H3,(H,25,27) |
| InChIKey | DOJZRCVHNWFJBI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|