C19H21BrN4O — CID 71902576
2-(3,4-dihydro-2H-quinolin-1-yl)-N-(3-imino-1H-isoindol-2-yl)acetamide;hydrobromide (PubChem CID 71902576) has the molecular formula C19H21BrN4O and a molecular weight of 401.31 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(3-imino-1H-isoindol-2-yl)acetamide;hydrobromide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(3-imino-1H-isoindol-2-yl)acetamide;hydrobromide |
|---|---|
| PubChem CID | 71902576 |
| Molecular Formula | C19H21BrN4O |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(3-imino-1H-isoindol-2-yl)acetamide;hydrobromide |
| SMILES | Br.[H]/N=C1\c2ccccc2CN1NC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C19H20N4O.BrH/c20-19-16-9-3-1-7-15(16)12-23(19)21-18(24)13-22-11-5-8-14-6-2-4-10-17(14)22;/h1-4,6-7,9-10,20H,5,8,11-13H2,(H,21,24);1H/b20-19+; |
| InChIKey | JVUZPBHGHARUPK-RZLHGTIFSA-N |
| XLogP | 2.89 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|