C17H19N3O — CID 71903618
1-(2-methylpiperidin-1-yl)-3-quinoxalin-2-ylprop-2-en-1-one (PubChem CID 71903618) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(2-methylpiperidin-1-yl)-3-quinoxalin-2-ylprop-2-en-1-one.
| Compound Name | 1-(2-methylpiperidin-1-yl)-3-quinoxalin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71903618 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(2-methylpiperidin-1-yl)-3-quinoxalin-2-ylprop-2-en-1-one |
| SMILES | CC1CCCCN1C(=O)C=Cc1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H19N3O/c1-13-6-4-5-11-20(13)17(21)10-9-14-12-18-15-7-2-3-8-16(15)19-14/h2-3,7-10,12-13H,4-6,11H2,1H3 |
| InChIKey | POSFGJAUWVQHAV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|