C18H23NO3 — CID 71904507
cyclopentyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 71904507) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is cyclopentyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | cyclopentyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 71904507 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | cyclopentyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | O=C(OC1CCCC1)C1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C18H23NO3/c20-17-12-15(18(21)22-16-8-4-5-9-16)13-19(17)11-10-14-6-2-1-3-7-14/h1-3,6-7,15-16H,4-5,8-13H2 |
| InChIKey | BLPBIVVCRZMTSQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |