C22H30N2O4 — CID 42902301
[1-(cyclohexylamino)-1-oxopropan-2-yl] 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 42902301) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 42902301 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | CC(OC(=O)C1CC(=O)N(CCc2ccccc2)C1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H30N2O4/c1-16(21(26)23-19-10-6-3-7-11-19)28-22(27)18-14-20(25)24(15-18)13-12-17-8-4-2-5-9-17/h2,4-5,8-9,16,18-19H,3,6-7,10-15H2,1H3,(H,23,26) |
| InChIKey | WLXGQDWQASHWRJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |