C17H22N2O4 — CID 71905690
3-methoxybutyl 2-(3-methoxyphenyl)-5-methyl-1H-imidazole-4-carboxylate (PubChem CID 71905690) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-methoxybutyl 2-(3-methoxyphenyl)-5-methyl-1H-imidazole-4-carboxylate.
| Compound Name | 3-methoxybutyl 2-(3-methoxyphenyl)-5-methyl-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 71905690 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-methoxybutyl 2-(3-methoxyphenyl)-5-methyl-1H-imidazole-4-carboxylate |
| SMILES | COc1cccc(-c2nc(C(=O)OCCC(C)OC)c(C)[nH]2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-11(21-3)8-9-23-17(20)15-12(2)18-16(19-15)13-6-5-7-14(10-13)22-4/h5-7,10-11H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | IOXPQPVMOJFPIO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |