C14H14F2N2O4S — CID 71906668
4-(2,5-difluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)butanamide (PubChem CID 71906668) has the molecular formula C14H14F2N2O4S and a molecular weight of 344.34 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)butanamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)butanamide |
|---|---|
| PubChem CID | 71906668 |
| Molecular Formula | C14H14F2N2O4S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)butanamide |
| SMILES | O=C(CCCc1cc(F)ccc1F)NS(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C14H14F2N2O4S/c15-11-4-5-13(16)10(8-11)2-1-3-14(19)18-23(20,21)9-12-6-7-22-17-12/h4-8H,1-3,9H2,(H,18,19) |
| InChIKey | CCROEKLNJOOGQX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |