About 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide
2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide (PubChem CID 71982396) has the molecular formula C13H14N2O4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide |
| PubChem CID | 71982396 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)Cc2ccon2)c(C)c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-9-3-4-12(10(2)7-9)13(16)15-20(17,18)8-11-5-6-19-14-11/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | WQYFVBZPHCQZOO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide?
The IUPAC name of 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide (CID 71982396) is 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide.
What is the SMILES notation for 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide?
The canonical SMILES for 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide is Cc1ccc(C(=O)NS(=O)(=O)Cc2ccon2)c(C)c1.
What is the InChIKey of 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide?
The InChIKey is WQYFVBZPHCQZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4S/c1-9-3-4-12(10(2)7-9)13(16)15-20(17,18)8-11-5-6-19-14-11/h3-7H,8H2,1-2H3,(H,15,16).
What are the key properties of 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide?
2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide has a molecular weight of 294.33 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N-(1,2-oxazol-3-ylmethylsulfonyl)benzamide is sourced from PubChem (CID 71982396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).