C12H12ClN5O — CID 71914219
5-chloro-N-[4-(dimethylamino)pyrimidin-5-yl]pyridine-2-carboxamide (PubChem CID 71914219) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is 5-chloro-N-[4-(dimethylamino)pyrimidin-5-yl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(dimethylamino)pyrimidin-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71914219 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-chloro-N-[4-(dimethylamino)pyrimidin-5-yl]pyridine-2-carboxamide |
| SMILES | CN(C)c1ncncc1NC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H12ClN5O/c1-18(2)11-10(6-14-7-16-11)17-12(19)9-4-3-8(13)5-15-9/h3-7H,1-2H3,(H,17,19) |
| InChIKey | UIZFTBYPPYJMQA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |