C16H18N6O — CID 86787104
1-[(4-cyanophenyl)methyl]-3-[4-(dimethylamino)pyrimidin-5-yl]-1-methylurea (PubChem CID 86787104) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-[4-(dimethylamino)pyrimidin-5-yl]-1-methylurea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-[4-(dimethylamino)pyrimidin-5-yl]-1-methylurea |
|---|---|
| PubChem CID | 86787104 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-[4-(dimethylamino)pyrimidin-5-yl]-1-methylurea |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)Nc1cncnc1N(C)C |
| InChI | InChI=1S/C16H18N6O/c1-21(2)15-14(9-18-11-19-15)20-16(23)22(3)10-13-6-4-12(8-17)5-7-13/h4-7,9,11H,10H2,1-3H3,(H,20,23) |
| InChIKey | RVTRTRPUJWWPEF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |