C15H17N7O3 — CID 71915147
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]urea (PubChem CID 71915147) has the molecular formula C15H17N7O3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]urea.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 71915147 |
| Molecular Formula | C15H17N7O3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCc1cn2ccccc2n1)NCCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C15H17N7O3/c23-15(17-6-8-21-11-13(9-18-21)22(24)25)16-5-4-12-10-20-7-2-1-3-14(20)19-12/h1-3,7,9-11H,4-6,8H2,(H2,16,17,23) |
| InChIKey | SXSKHSOFUHXNOQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|