C17H24N2O2S — CID 71920611
methyl 5-(1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-ylmethyl)thiophene-2-carboxylate (PubChem CID 71920611) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is methyl 5-(1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-ylmethyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-(1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-ylmethyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71920611 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl 5-(1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-ylmethyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CC3CN4CCCCC4C3C2)s1 |
| InChI | InChI=1S/C17H24N2O2S/c1-21-17(20)16-6-5-13(22-16)10-18-8-12-9-19-7-3-2-4-15(19)14(12)11-18/h5-6,12,14-15H,2-4,7-11H2,1H3 |
| InChIKey | TXGHUHMIVOIEGD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |