C18H22ClN5 — CID 71933909
1-phenyl-3-[3-(pyridin-3-ylmethylamino)propyl]pyrazol-5-amine;hydrochloride (PubChem CID 71933909) has the molecular formula C18H22ClN5 and a molecular weight of 343.86 g/mol. Its IUPAC name is 1-phenyl-3-[3-(pyridin-3-ylmethylamino)propyl]pyrazol-5-amine;hydrochloride.
| Compound Name | 1-phenyl-3-[3-(pyridin-3-ylmethylamino)propyl]pyrazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 71933909 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-phenyl-3-[3-(pyridin-3-ylmethylamino)propyl]pyrazol-5-amine;hydrochloride |
| SMILES | Cl.Nc1cc(CCCNCc2cccnc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H21N5.ClH/c19-18-12-16(22-23(18)17-8-2-1-3-9-17)7-5-11-21-14-15-6-4-10-20-13-15;/h1-4,6,8-10,12-13,21H,5,7,11,14,19H2;1H |
| InChIKey | VAWHYBLFABANOB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|