C16H20N2O3S — CID 71939376
2-phenyl-N-(6-propan-2-yloxy-3-pyridinyl)ethanesulfonamide (PubChem CID 71939376) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-phenyl-N-(6-propan-2-yloxy-3-pyridinyl)ethanesulfonamide.
| Compound Name | 2-phenyl-N-(6-propan-2-yloxy-3-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 71939376 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-phenyl-N-(6-propan-2-yloxy-3-pyridinyl)ethanesulfonamide |
| SMILES | CC(C)Oc1ccc(NS(=O)(=O)CCc2ccccc2)cn1 |
| InChI | InChI=1S/C16H20N2O3S/c1-13(2)21-16-9-8-15(12-17-16)18-22(19,20)11-10-14-6-4-3-5-7-14/h3-9,12-13,18H,10-11H2,1-2H3 |
| InChIKey | DLSLIDABPJDAEB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |