C15H22N2O7S — CID 71945516
2-[[2-hydroxy-3-[methyl-(4-methylphenyl)sulfonylamino]propyl]amino]butanedioic acid (PubChem CID 71945516) has the molecular formula C15H22N2O7S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-[methyl-(4-methylphenyl)sulfonylamino]propyl]amino]butanedioic acid.
| Compound Name | 2-[[2-hydroxy-3-[methyl-(4-methylphenyl)sulfonylamino]propyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 71945516 |
| Molecular Formula | C15H22N2O7S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[[2-hydroxy-3-[methyl-(4-methylphenyl)sulfonylamino]propyl]amino]butanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(O)CNC(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O7S/c1-10-3-5-12(6-4-10)25(23,24)17(2)9-11(18)8-16-13(15(21)22)7-14(19)20/h3-6,11,13,16,18H,7-9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RJXZOFPLTWPBHF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |