C26H29N3O3 — CID 71947282
2-cyano-3-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 71947282) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 71947282 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-cyano-3-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C=C(C#N)C(=O)NC3CCCCC3C)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-18-7-11-22(12-8-18)28-25(30)17-32-23-13-9-20(10-14-23)15-21(16-27)26(31)29-24-6-4-3-5-19(24)2/h7-15,19,24H,3-6,17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | LTHDIUBJMWFOSZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|