C23H30ClN3O6S — CID 71953370
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 71953370) has the molecular formula C23H30ClN3O6S and a molecular weight of 512.03 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71953370 |
| Molecular Formula | C23H30ClN3O6S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)C=Cc2c(C)nn(C3CCS(=O)(=O)C3)c2Cl)c1C |
| InChI | InChI=1S/C23H30ClN3O6S/c1-15-12-20(17(3)26(15)9-5-10-32-4)21(28)13-33-22(29)7-6-19-16(2)25-27(23(19)24)18-8-11-34(30,31)14-18/h6-7,12,18H,5,8-11,13-14H2,1-4H3 |
| InChIKey | QUFXUDQNVGIGSR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|