C17H16N2O4S — CID 71957879
3-(3,5-dimethoxyphenyl)-5-(furan-2-ylmethylidene)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 71957879) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-5-(furan-2-ylmethylidene)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3,5-dimethoxyphenyl)-5-(furan-2-ylmethylidene)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 71957879 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-5-(furan-2-ylmethylidene)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(OC)cc(N2C(=O)C(=Cc3ccco3)N(C)C2=S)c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-18-15(10-12-5-4-6-23-12)16(20)19(17(18)24)11-7-13(21-2)9-14(8-11)22-3/h4-10H,1-3H3 |
| InChIKey | FWRLKKSXVZOHMH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|