C20H14N2O2S — CID 936275
5-(furan-2-ylmethylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 936275) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-(furan-2-ylmethylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(furan-2-ylmethylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 936275 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-(furan-2-ylmethylidene)-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1C(=Cc2ccco2)N(c2ccccc2)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C20H14N2O2S/c23-19-18(14-17-12-7-13-24-17)21(15-8-3-1-4-9-15)20(25)22(19)16-10-5-2-6-11-16/h1-14H |
| InChIKey | XGMUFEBYWCEAHX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|