C19H26N4O6 — CID 7196177
N'-[[(2S)-3-(1,3-benzodioxole-5-carbonyl)-1,3-oxazolidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]oxamide (PubChem CID 7196177) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is N'-[[(2S)-3-(1,3-benzodioxole-5-carbonyl)-1,3-oxazolidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]oxamide.
| Compound Name | N'-[[(2S)-3-(1,3-benzodioxole-5-carbonyl)-1,3-oxazolidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]oxamide |
|---|---|
| PubChem CID | 7196177 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N'-[[(2S)-3-(1,3-benzodioxole-5-carbonyl)-1,3-oxazolidin-2-yl]methyl]-N-[3-(dimethylamino)propyl]oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)NC[C@@H]1OCCN1C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26N4O6/c1-22(2)7-3-6-20-17(24)18(25)21-11-16-23(8-9-27-16)19(26)13-4-5-14-15(10-13)29-12-28-14/h4-5,10,16H,3,6-9,11-12H2,1-2H3,(H,20,24)(H,21,25)/t16-/m0/s1 |
| InChIKey | YTTJDYGABAXZNN-INIZCTEOSA-N |
| XLogP | -0.60 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|