C16H9F3N2O2S3 — CID 71962953
3-thiophen-2-yl-N-[4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 71962953) has the molecular formula C16H9F3N2O2S3 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-thiophen-2-yl-N-[4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-thiophen-2-yl-N-[4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71962953 |
| Molecular Formula | C16H9F3N2O2S3 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 3-thiophen-2-yl-N-[4-thiophen-2-yl-5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)Nc1nc(-c2cccs2)c(C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C16H9F3N2O2S3/c17-16(18,19)14(23)13-12(10-4-2-8-25-10)21-15(26-13)20-11(22)6-5-9-3-1-7-24-9/h1-8H,(H,20,21,22) |
| InChIKey | JEYFPZPEKCCQMT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|