C20H21N3O3S — CID 71963608
2-(3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 71963608) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 71963608 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | CC1NC(=O)c2ccccc2N(CC(=O)NCCSc2ccccc2)C1=O |
| InChI | InChI=1S/C20H21N3O3S/c1-14-20(26)23(17-10-6-5-9-16(17)19(25)22-14)13-18(24)21-11-12-27-15-7-3-2-4-8-15/h2-10,14H,11-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | ABABOXQPXPOQTO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|