C20H20ClN3O3S — CID 71692079
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(3S)-3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]acetamide (PubChem CID 71692079) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(3S)-3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(3S)-3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]acetamide |
|---|---|
| PubChem CID | 71692079 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(3S)-3-methyl-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]acetamide |
| SMILES | C[C@@H]1NC(=O)c2ccccc2N(CC(=O)NCCSc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H20ClN3O3S/c1-13-20(27)24(17-5-3-2-4-16(17)19(26)23-13)12-18(25)22-10-11-28-15-8-6-14(21)7-9-15/h2-9,13H,10-12H2,1H3,(H,22,25)(H,23,26)/t13-/m0/s1 |
| InChIKey | SHHPUYFPEKFBAQ-ZDUSSCGKSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|