C22H18Cl2N2O3S2 — CID 28591795
2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide (PubChem CID 28591795) has the molecular formula C22H18Cl2N2O3S2 and a molecular weight of 493.44 g/mol. Its IUPAC name is 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 28591795 |
| Molecular Formula | C22H18Cl2N2O3S2 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
| SMILES | O=C(CN1c2ccc(Cl)cc2-c2ccccc2S1(=O)=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3S2/c23-15-5-8-17(9-6-15)30-12-11-25-22(27)14-26-20-10-7-16(24)13-19(20)18-3-1-2-4-21(18)31(26,28)29/h1-10,13H,11-12,14H2,(H,25,27) |
| InChIKey | DCHYFDZJLJMPHC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|