C24H23ClN2O3S2 — CID 28591749
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide (PubChem CID 28591749) has the molecular formula C24H23ClN2O3S2 and a molecular weight of 487.05 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 28591749 |
| Molecular Formula | C24H23ClN2O3S2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
| SMILES | Cc1ccc2c(c1)-c1ccccc1S(=O)(=O)N2CC(=O)NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O3S2/c1-17-6-11-22-21(14-17)20-4-2-3-5-23(20)32(29,30)27(22)15-24(28)26-12-13-31-16-18-7-9-19(25)10-8-18/h2-11,14H,12-13,15-16H2,1H3,(H,26,28) |
| InChIKey | LAINDYLPNFOCTA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|