C22H18ClFN2O3S2 — CID 92642741
N-[2-(4-chlorophenyl)sulfanylethyl]-2-(9-fluoro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide (PubChem CID 92642741) has the molecular formula C22H18ClFN2O3S2 and a molecular weight of 476.98 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-(9-fluoro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-(9-fluoro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 92642741 |
| Molecular Formula | C22H18ClFN2O3S2 |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-(9-fluoro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
| SMILES | O=C(CN1c2ccc(F)cc2-c2ccccc2S1(=O)=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClFN2O3S2/c23-15-5-8-17(9-6-15)30-12-11-25-22(27)14-26-20-10-7-16(24)13-19(20)18-3-1-2-4-21(18)31(26,28)29/h1-10,13H,11-12,14H2,(H,25,27) |
| InChIKey | LZDXRISCVJHUNS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|