C23H20Cl2N2O3S2 — CID 28591800
2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 28591800) has the molecular formula C23H20Cl2N2O3S2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 28591800 |
| Molecular Formula | C23H20Cl2N2O3S2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN1c2ccc(Cl)cc2-c2ccccc2S1(=O)=O)NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O3S2/c24-17-7-5-16(6-8-17)15-31-12-11-26-23(28)14-27-21-10-9-18(25)13-20(21)19-3-1-2-4-22(19)32(27,29)30/h1-10,13H,11-12,14-15H2,(H,26,28) |
| InChIKey | XLEWKFADUPKBFN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|