C15H20ClN5O — CID 71965813
[(2R)-4-methyl-1-oxo-1-[2-(quinoxalin-6-ylmethylidene)hydrazinyl]pentan-2-yl]azanium chloride (PubChem CID 71965813) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is [(2R)-4-methyl-1-oxo-1-[2-(quinoxalin-6-ylmethylidene)hydrazinyl]pentan-2-yl]azanium chloride.
| Compound Name | [(2R)-4-methyl-1-oxo-1-[2-(quinoxalin-6-ylmethylidene)hydrazinyl]pentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 71965813 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(2R)-4-methyl-1-oxo-1-[2-(quinoxalin-6-ylmethylidene)hydrazinyl]pentan-2-yl]azanium chloride |
| SMILES | CC(C)C[C@@H]([NH3+])C(=O)NN=Cc1ccc2nccnc2c1.[Cl-] |
| InChI | InChI=1S/C15H19N5O.ClH/c1-10(2)7-12(16)15(21)20-19-9-11-3-4-13-14(8-11)18-6-5-17-13;/h3-6,8-10,12H,7,16H2,1-2H3,(H,20,21);1H/t12-;/m1./s1 |
| InChIKey | SKGBHEUUQWTKEA-UTONKHPSSA-N |
| XLogP | -2.26 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|