C14H18ClN5O — CID 73307558
2-amino-3-methyl-N-(quinoxalin-6-ylmethylideneamino)butanamide;hydrochloride (PubChem CID 73307558) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(quinoxalin-6-ylmethylideneamino)butanamide;hydrochloride.
| Compound Name | 2-amino-3-methyl-N-(quinoxalin-6-ylmethylideneamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 73307558 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-amino-3-methyl-N-(quinoxalin-6-ylmethylideneamino)butanamide;hydrochloride |
| SMILES | CC(C)C(N)C(=O)NN=Cc1ccc2nccnc2c1.Cl |
| InChI | InChI=1S/C14H17N5O.ClH/c1-9(2)13(15)14(20)19-18-8-10-3-4-11-12(7-10)17-6-5-16-11;/h3-9,13H,15H2,1-2H3,(H,19,20);1H |
| InChIKey | GGWXCNWQIDVRKY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|