C11H24Br4N2 — CID 71966197
[2,3-dibromo-5-(trimethylazaniumyl)pent-3-enyl]-trimethylazanium dibromide (PubChem CID 71966197) has the molecular formula C11H24Br4N2 and a molecular weight of 503.94 g/mol. Its IUPAC name is [2,3-dibromo-5-(trimethylazaniumyl)pent-3-enyl]-trimethylazanium dibromide.
| Compound Name | [2,3-dibromo-5-(trimethylazaniumyl)pent-3-enyl]-trimethylazanium dibromide |
|---|---|
| PubChem CID | 71966197 |
| Molecular Formula | C11H24Br4N2 |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 499.87 |
| IUPAC Name | [2,3-dibromo-5-(trimethylazaniumyl)pent-3-enyl]-trimethylazanium dibromide |
| SMILES | C[N+](C)(C)CC=C(Br)C(Br)C[N+](C)(C)C.[Br-].[Br-] |
| InChI | InChI=1S/C11H24Br2N2.2BrH/c1-14(2,3)8-7-10(12)11(13)9-15(4,5)6;;/h7,11H,8-9H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | FPZYZPJERIRDJG-UHFFFAOYSA-L |
| XLogP | -3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|