C17H12BrCl2NO2 — CID 71966552
4-bromo-2-[3-(2,3-dichlorophenyl)prop-2-enoyl]-7-(methylamino)cyclohepta-2,4,6-trien-1-one (PubChem CID 71966552) has the molecular formula C17H12BrCl2NO2 and a molecular weight of 413.10 g/mol. Its IUPAC name is 4-bromo-2-[3-(2,3-dichlorophenyl)prop-2-enoyl]-7-(methylamino)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-bromo-2-[3-(2,3-dichlorophenyl)prop-2-enoyl]-7-(methylamino)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 71966552 |
| Molecular Formula | C17H12BrCl2NO2 |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 4-bromo-2-[3-(2,3-dichlorophenyl)prop-2-enoyl]-7-(methylamino)cyclohepta-2,4,6-trien-1-one |
| SMILES | CNc1ccc(Br)cc(C(=O)C=Cc2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C17H12BrCl2NO2/c1-21-14-7-6-11(18)9-12(17(14)23)15(22)8-5-10-3-2-4-13(19)16(10)20/h2-9H,1H3,(H,21,23) |
| InChIKey | MFZMNRDZDHTFGX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|