C11H11F3N4OS2 — CID 71968288
2,2,2-trifluoro-N-[3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propyl]acetamide (PubChem CID 71968288) has the molecular formula C11H11F3N4OS2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 71968288 |
| Molecular Formula | C11H11F3N4OS2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propyl]acetamide |
| SMILES | O=C(NCCCSc1n[nH]c(-c2cccs2)n1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N4OS2/c12-11(13,14)9(19)15-4-2-6-21-10-16-8(17-18-10)7-3-1-5-20-7/h1,3,5H,2,4,6H2,(H,15,19)(H,16,17,18) |
| InChIKey | KSUKCTRNOUDBEP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|