C11H15N3S2 — CID 75415148
3-pentylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 75415148) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 3-pentylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-pentylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 75415148 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-pentylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | CCCCCSc1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C11H15N3S2/c1-2-3-4-7-16-11-12-10(13-14-11)9-6-5-8-15-9/h5-6,8H,2-4,7H2,1H3,(H,12,13,14) |
| InChIKey | NLNUXKFLCRNEAH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|