C13H23NO2 — CID 71970125
1-hydroxy-N-(2-methylcyclohexyl)cyclopentane-1-carboxamide (PubChem CID 71970125) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-hydroxy-N-(2-methylcyclohexyl)cyclopentane-1-carboxamide.
| Compound Name | 1-hydroxy-N-(2-methylcyclohexyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 71970125 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-hydroxy-N-(2-methylcyclohexyl)cyclopentane-1-carboxamide |
| SMILES | CC1CCCCC1NC(=O)C1(O)CCCC1 |
| InChI | InChI=1S/C13H23NO2/c1-10-6-2-3-7-11(10)14-12(15)13(16)8-4-5-9-13/h10-11,16H,2-9H2,1H3,(H,14,15) |
| InChIKey | XVOJDDMPZFZWEW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |