C16H14N2O5S — CID 7197015
naphthalen-2-yl 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (PubChem CID 7197015) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is naphthalen-2-yl 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
| Compound Name | naphthalen-2-yl 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7197015 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | naphthalen-2-yl 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| SMILES | Cn1cc(S(=O)(=O)Oc2ccc3ccccc3c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H14N2O5S/c1-17-10-14(15(19)18(2)16(17)20)24(21,22)23-13-8-7-11-5-3-4-6-12(11)9-13/h3-10H,1-2H3 |
| InChIKey | TWFBSYNQHVKAPX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|