C12H8F3NO3S — CID 71975700
2,3-difluoro-N-(5-fluoro-2-hydroxyphenyl)benzenesulfonamide (PubChem CID 71975700) has the molecular formula C12H8F3NO3S and a molecular weight of 303.26 g/mol. Its IUPAC name is 2,3-difluoro-N-(5-fluoro-2-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2,3-difluoro-N-(5-fluoro-2-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71975700 |
| Molecular Formula | C12H8F3NO3S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2,3-difluoro-N-(5-fluoro-2-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H8F3NO3S/c13-7-4-5-10(17)9(6-7)16-20(18,19)11-3-1-2-8(14)12(11)15/h1-6,16-17H |
| InChIKey | NIPIEJKSSJYUKH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|