C18H27FN2O3 — CID 71977305
1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(2-propan-2-yloxolan-3-yl)methyl]urea (PubChem CID 71977305) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(2-propan-2-yloxolan-3-yl)methyl]urea.
| Compound Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(2-propan-2-yloxolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71977305 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(2-propan-2-yloxolan-3-yl)methyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCC2CCOC2C(C)C)cc1F |
| InChI | InChI=1S/C18H27FN2O3/c1-11(2)17-14(7-8-24-17)10-20-18(22)21-12(3)13-5-6-16(23-4)15(19)9-13/h5-6,9,11-12,14,17H,7-8,10H2,1-4H3,(H2,20,21,22) |
| InChIKey | JWTJZKHFRVJQED-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |