C14H20N2O2S2 — CID 71979779
N-[2-[(2-ethylsulfanylcyclopentyl)amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 71979779) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[2-[(2-ethylsulfanylcyclopentyl)amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(2-ethylsulfanylcyclopentyl)amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71979779 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[2-[(2-ethylsulfanylcyclopentyl)amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCSC1CCCC1NC(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H20N2O2S2/c1-2-19-11-6-3-5-10(11)16-13(17)9-15-14(18)12-7-4-8-20-12/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | OVCNDUXZYBIOJY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |