C17H23NO2S — CID 71981316
3-(2,5-dimethylphenyl)sulfanyl-1-(oxan-4-yl)pyrrolidin-2-one (PubChem CID 71981316) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)sulfanyl-1-(oxan-4-yl)pyrrolidin-2-one.
| Compound Name | 3-(2,5-dimethylphenyl)sulfanyl-1-(oxan-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71981316 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-(2,5-dimethylphenyl)sulfanyl-1-(oxan-4-yl)pyrrolidin-2-one |
| SMILES | Cc1ccc(C)c(SC2CCN(C3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C17H23NO2S/c1-12-3-4-13(2)16(11-12)21-15-5-8-18(17(15)19)14-6-9-20-10-7-14/h3-4,11,14-15H,5-10H2,1-2H3 |
| InChIKey | ZCDWHRWDVDPELJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |